Difference between revisions of "CPD-17397"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...")
(Created page with "Category:metabolite == Metabolite CPD-17397 == * common-name: ** a [glycerolipid]-densipolate == Reaction(s) known to consume the compound == * RXN-16150 == Reaction(s...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-365 ==
+
== Metabolite CPD-17397 ==
 
* common-name:
 
* common-name:
** 1-keto-d-chiro-inositol
+
** a [glycerolipid]-densipolate
* smiles:
 
** c1(o)(c(o)c(o)c(=o)c(o)c(o)1)
 
* inchi-key:
 
** vyegbdhsghxogt-qfycrykcsa-n
 
* molecular-weight:
 
** 178.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14148]]
+
* [[RXN-16150]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14148]]
+
* [[RXN-16149]]
 +
* [[RXN-16150]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-keto-d-chiro-inositol}}
+
{{#set: common-name=a [glycerolipid]-densipolate}}
{{#set: inchi-key=inchikey=vyegbdhsghxogt-qfycrykcsa-n}}
 
{{#set: molecular-weight=178.141}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-17397

  • common-name:
    • a [glycerolipid]-densipolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-densipolate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.