Difference between revisions of "CPD-17397"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...") |
(Created page with "Category:metabolite == Metabolite CPD-17397 == * common-name: ** a [glycerolipid]-densipolate == Reaction(s) known to consume the compound == * RXN-16150 == Reaction(s...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-17397 == |
* common-name: | * common-name: | ||
− | ** | + | ** a [glycerolipid]-densipolate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16150]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16149]] |
+ | * [[RXN-16150]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-densipolate}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-17397
- common-name:
- a [glycerolipid]-densipolate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-densipolate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.