Difference between revisions of "CPD-17397"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7676 == * common-name: ** methyl iodide * smiles: ** ci * inchi-key: ** inqombqausqdds-uhfffaoysa-n * molecular-weight: ** 141.939 ==...")
(Created page with "Category:metabolite == Metabolite CPD-17365 == * common-name: ** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7676 ==
+
== Metabolite CPD-17365 ==
 
* common-name:
 
* common-name:
** methyl iodide
+
** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa
 
* smiles:
 
* smiles:
** ci
+
** cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** inqombqausqdds-uhfffaoysa-n
+
** qkbtyzdpvnterq-uwvcyphhsa-j
 
* molecular-weight:
 
* molecular-weight:
** 141.939
+
** 1075.997
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11241]]
+
* [[RXN-17116]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methyl iodide}}
+
{{#set: common-name=(4z,7z,10z,13z,16z)-docosapentaenoyl-coa}}
{{#set: inchi-key=inchikey=inqombqausqdds-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=qkbtyzdpvnterq-uwvcyphhsa-j}}
{{#set: molecular-weight=141.939}}
+
{{#set: molecular-weight=1075.997}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-17365

  • common-name:
    • (4z,7z,10z,13z,16z)-docosapentaenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qkbtyzdpvnterq-uwvcyphhsa-j
  • molecular-weight:
    • 1075.997

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality