Difference between revisions of "CPD-17399"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ASPARTATE == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)[o-] * inchi-key: ** ckljmwtzizzhcs-reohclbhsa-m * mole...") |
(Created page with "Category:metabolite == Metabolite Histone-L-arginines == * common-name: ** [histone]-l-arginine == Reaction(s) known to consume the compound == * 2.1.1.125-RXN == Reac...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite L- | + | == Metabolite Histone-L-arginines == |
* common-name: | * common-name: | ||
− | ** | + | ** [histone]-l-arginine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.1.1.125-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=l- | + | {{#set: common-name=[histone]-l-arginine}} |
− | |||
− |
Revision as of 15:26, 5 January 2021
Contents
Metabolite Histone-L-arginines
- common-name:
- [histone]-l-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "histone]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.