Difference between revisions of "CPD-17400"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYS-GLY == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+])=o * inchi-key: ** zukpvrwzdmrieo-vkhmyheasa-n * m...") |
(Created page with "Category:metabolite == Metabolite CPD-17400 == * common-name: ** a [glycerolipid]-lesquerolate == Reaction(s) known to consume the compound == * RXN-14491 == Reaction(...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17400 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [glycerolipid]-lesquerolate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14491]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16152]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [glycerolipid]-lesquerolate}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-17400
- common-name:
- a [glycerolipid]-lesquerolate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [glycerolipid]-lesquerolate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
