Difference between revisions of "CPD-17400"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4618 == * common-name: ** cis-zeatin-7-n-glucoside * smiles: ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD66-28 == * common-name: ** pregn-5-ene-3,20-dione * smiles: ** cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34)))) * inchi-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD66-28 == |
* common-name: | * common-name: | ||
| − | ** | + | ** pregn-5-ene-3,20-dione |
* smiles: | * smiles: | ||
| − | ** cc(= | + | ** cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mnrhzpcieglwgk-lekssakusa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 314.467 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-353]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-353]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pregn-5-ene-3,20-dione}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mnrhzpcieglwgk-lekssakusa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=314.467}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD66-28
- common-name:
- pregn-5-ene-3,20-dione
- smiles:
- cc(=o)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- mnrhzpcieglwgk-lekssakusa-n
- molecular-weight:
- 314.467
