Difference between revisions of "CPD-17400"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine-sulfinate == * common-name: ** an n-terminal 3-sulfino-l-alanyl-[protein] == Reaction(s) known to consume the compo...")
(Created page with "Category:metabolite == Metabolite SACCHAROPINE == * common-name: ** l-saccharopine * smiles: ** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o * inchi-key: ** zdgjahtzv...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-terminal-L-cysteine-sulfinate ==
+
== Metabolite SACCHAROPINE ==
 
* common-name:
 
* common-name:
** an n-terminal 3-sulfino-l-alanyl-[protein]
+
** l-saccharopine
 +
* smiles:
 +
** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o
 +
* inchi-key:
 +
** zdgjahtzvhvlot-yumqzzprsa-m
 +
* molecular-weight:
 +
** 275.281
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17890]]
+
* [[1.5.1.9-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-terminal 3-sulfino-l-alanyl-[protein]}}
+
{{#set: common-name=l-saccharopine}}
 +
{{#set: inchi-key=inchikey=zdgjahtzvhvlot-yumqzzprsa-m}}
 +
{{#set: molecular-weight=275.281}}

Revision as of 13:10, 14 January 2021

Metabolite SACCHAROPINE

  • common-name:
    • l-saccharopine
  • smiles:
    • c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o
  • inchi-key:
    • zdgjahtzvhvlot-yumqzzprsa-m
  • molecular-weight:
    • 275.281

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality