Difference between revisions of "CPD-17401"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11875 == * common-name: ** normetanephrine * smiles: ** coc1(=c(o)c=cc(c(o)c[n+])=c1) * inchi-key: ** ynyaywlbahxhll-qmmmgpobsa-o * m...")
(Created page with "Category:metabolite == Metabolite CPD-17401 == * common-name: ** 3-oxo-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11875 ==
+
== Metabolite CPD-17401 ==
 
* common-name:
 
* common-name:
** normetanephrine
+
** 3-oxo-auricoloyl-coa
 
* smiles:
 
* smiles:
** coc1(=c(o)c=cc(c(o)c[n+])=c1)
+
** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ynyaywlbahxhll-qmmmgpobsa-o
+
** fgcwebktqlbclr-jrszcninsa-j
 
* molecular-weight:
 
* molecular-weight:
** 184.214
+
** 1083.973
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10910]]
+
* [[RXN-16154]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16153]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=normetanephrine}}
+
{{#set: common-name=3-oxo-auricoloyl-coa}}
{{#set: inchi-key=inchikey=ynyaywlbahxhll-qmmmgpobsa-o}}
+
{{#set: inchi-key=inchikey=fgcwebktqlbclr-jrszcninsa-j}}
{{#set: molecular-weight=184.214}}
+
{{#set: molecular-weight=1083.973}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-17401

  • common-name:
    • 3-oxo-auricoloyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fgcwebktqlbclr-jrszcninsa-j
  • molecular-weight:
    • 1083.973

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality