Difference between revisions of "CPD-17401"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11875 == * common-name: ** normetanephrine * smiles: ** coc1(=c(o)c=cc(c(o)c[n+])=c1) * inchi-key: ** ynyaywlbahxhll-qmmmgpobsa-o * m...") |
(Created page with "Category:metabolite == Metabolite Nonmethylated-Ribosomal-Protein-L11s == * common-name: ** a non-methylated ribosomal protein l11 == Reaction(s) known to consume the comp...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Nonmethylated-Ribosomal-Protein-L11s == |
* common-name: | * common-name: | ||
| − | ** | + | ** a non-methylated ribosomal protein l11 |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-5419]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a non-methylated ribosomal protein l11}} |
| − | |||
| − | |||
Revision as of 15:28, 5 January 2021
Contents
Metabolite Nonmethylated-Ribosomal-Protein-L11s
- common-name:
- a non-methylated ribosomal protein l11
