Difference between revisions of "CPD-17402"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Xyloglucans-Galactose-23 == * common-name: ** an xllg xylogulcan == Reaction(s) known to consume the compound == * RXN-9463 == Reacti...") |
(Created page with "Category:metabolite == Metabolite CPD-17402 == * common-name: ** (3r)-hydroxy-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17402 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (3r)-hydroxy-auricoloyl-coa |
| + | * smiles: | ||
| + | ** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** xtsclycoojhttr-ktfrusdtsa-j | ||
| + | * molecular-weight: | ||
| + | ** 1085.989 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16155]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16154]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(3r)-hydroxy-auricoloyl-coa}} |
| + | {{#set: inchi-key=inchikey=xtsclycoojhttr-ktfrusdtsa-j}} | ||
| + | {{#set: molecular-weight=1085.989}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-17402
- common-name:
- (3r)-hydroxy-auricoloyl-coa
- smiles:
- ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xtsclycoojhttr-ktfrusdtsa-j
- molecular-weight:
- 1085.989
