Difference between revisions of "CPD-17403"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06630 == * transcription-direction: ** negative * right-end-position: ** 22556 * left-end-position: ** 19247 * centisome-position: ** 25.0374 =...") |
(Created page with "Category:metabolite == Metabolite CPD-17403 == * common-name: ** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-17403 == |
| − | * | + | * common-name: |
| − | ** | + | ** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa |
| − | + | * smiles: | |
| − | + | ** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
| − | + | * inchi-key: | |
| − | + | ** gccbkkqiemqvgw-pkayedjnsa-j | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 1067.974 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | = | + | * [[RXN-16155]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=(2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa}} |
| − | ** | + | {{#set: inchi-key=inchikey=gccbkkqiemqvgw-pkayedjnsa-j}} |
| − | * | + | {{#set: molecular-weight=1067.974}} |
| − | ** | ||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-17403
- common-name:
- (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa
- smiles:
- ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- gccbkkqiemqvgw-pkayedjnsa-j
- molecular-weight:
- 1067.974
