Difference between revisions of "CPD-17403"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20209 == * transcription-direction: ** negative * right-end-position: ** 157511 * left-end-position: ** 150624 * centisome-position: ** 71.29759...")
(Created page with "Category:metabolite == Metabolite CPD-17403 == * common-name: ** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ20209 ==
+
== Metabolite CPD-17403 ==
* transcription-direction:
+
* common-name:
** negative
+
** (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa
* right-end-position:
+
* smiles:
** 157511
+
** ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 150624
+
** gccbkkqiemqvgw-pkayedjnsa-j
* centisome-position:
+
* molecular-weight:
** 71.29759   
+
** 1067.974
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-16155]]
* [[PYRNUTRANSHYDROGEN-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=gccbkkqiemqvgw-pkayedjnsa-j}}
== Pathway(s) associated ==
+
{{#set: molecular-weight=1067.974}}
* [[PWY-5083]]
 
** '''5''' reactions found over '''6''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=157511}}
 
{{#set: left-end-position=150624}}
 
{{#set: centisome-position=71.29759    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17403

  • common-name:
    • (2e,11z,17z)-14r-hydroxy-icosa-11,17-trienoyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • gccbkkqiemqvgw-pkayedjnsa-j
  • molecular-weight:
    • 1067.974

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality