|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.119-RXN 2.4.1.119-RXN] == | + | == Metabolite CPD-17540 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** dolichyl-diphosphooligosaccharide-protein glycotransferase | + | ** dapdiamide b |
| − | ** dolichyl-diphospho-oligosaccharide-protein glycosyltransferase | + | * smiles: |
| − | * ec-number:
| + | ** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o |
| − | ** [http://enzyme.expasy.org/EC/2.4.99.18 ec-2.4.99.18] | + | * inchi-key: |
| − | == Reaction formula ==
| + | ** wsfqksibzodgpb-ofaneystsa-n |
| − | * 1 [[CPD-18076]][c] '''+''' 1 [[Protein-L-Asparagine]][c] '''=>''' 1 [[CPD-18077]][c] '''+''' 1 [[CPD-224]][c] '''+''' 1 [[PROTON]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction == | + | ** 314.341 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ04308]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[orthology]]
| + | * [[RXN-16292]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ18586]]
| + | {{#set: common-name=dapdiamide b}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=wsfqksibzodgpb-ofaneystsa-n}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: molecular-weight=314.341}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ19404]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ12004]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ02055]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ08534]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]], protein N-glycosylation initial phase (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]
| |
| − | ** '''16''' reactions found over '''19''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=50349 50349]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P39656 P39656]
| |
| − | ** [http://www.uniprot.org/uniprot/P48440 P48440]
| |
| − | ** [http://www.uniprot.org/uniprot/P41543 P41543]
| |
| − | ** [http://www.uniprot.org/uniprot/P80896 P80896]
| |
| − | ** [http://www.uniprot.org/uniprot/P80897 P80897]
| |
| − | ** [http://www.uniprot.org/uniprot/P48439 P48439]
| |
| − | ** [http://www.uniprot.org/uniprot/P46964 P46964]
| |
| − | ** [http://www.uniprot.org/uniprot/Q92316 Q92316]
| |
| − | ** [http://www.uniprot.org/uniprot/Q10176 Q10176]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=dolichyl-diphosphooligosaccharide-protein glycotransferase|dolichyl-diphospho-oligosaccharide-protein glycosyltransferase}} | |
| − | {{#set: ec-number=ec-2.4.99.18}} | |
| − | {{#set: nb gene associated=6}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
