Difference between revisions of "CPD-17540"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11647 == * common-name: ** thermospermine * smiles: ** c([n+])ccc[n+]ccc[n+]ccc[n+] * inchi-key: ** doddbcgmrafleb-uhfffaoysa-r * mol...")
(Created page with "Category:metabolite == Metabolite CPD-17540 == * common-name: ** dapdiamide b * smiles: ** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** wsfqksibzodgpb-o...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11647 ==
+
== Metabolite CPD-17540 ==
 
* common-name:
 
* common-name:
** thermospermine
+
** dapdiamide b
 
* smiles:
 
* smiles:
** c([n+])ccc[n+]ccc[n+]ccc[n+]
+
** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
 
* inchi-key:
 
* inchi-key:
** doddbcgmrafleb-uhfffaoysa-r
+
** wsfqksibzodgpb-ofaneystsa-n
 
* molecular-weight:
 
* molecular-weight:
** 206.374
+
** 314.341
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11190]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11190]]
+
* [[RXN-16292]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thermospermine}}
+
{{#set: common-name=dapdiamide b}}
{{#set: inchi-key=inchikey=doddbcgmrafleb-uhfffaoysa-r}}
+
{{#set: inchi-key=inchikey=wsfqksibzodgpb-ofaneystsa-n}}
{{#set: molecular-weight=206.374}}
+
{{#set: molecular-weight=314.341}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-17540

  • common-name:
    • dapdiamide b
  • smiles:
    • ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
  • inchi-key:
    • wsfqksibzodgpb-ofaneystsa-n
  • molecular-weight:
    • 314.341

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality