Difference between revisions of "CPD-17540"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-DIHYDROXY-PHENYLALANINE == * common-name: ** l-dopa * smiles: ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] * inchi-key: ** wtdrdqbearuvnc-...") |
(Created page with "Category:metabolite == Metabolite Ferrihemoglobins == * common-name: ** a ferrihemoglobin == Reaction(s) known to consume the compound == * RXN-11195 == Reaction(s) kn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Ferrihemoglobins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a ferrihemoglobin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11195]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a ferrihemoglobin}} |
| − | |||
| − | |||
Revision as of 13:13, 14 January 2021
Contents
Metabolite Ferrihemoglobins
- common-name:
- a ferrihemoglobin
