Difference between revisions of "CPD-17541"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LC-alcohol-LC-acyl-ester == * common-name: ** a long-chain alcohol--long-chain acyl wax ester == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALPHA-D-GALACTOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-galactose |
| + | * smiles: | ||
| + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) | ||
| + | * inchi-key: | ||
| + | ** wqzgkkkjijffok-phyprbdbsa-n | ||
| + | * molecular-weight: | ||
| + | ** 180.157 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ALDOSE1EPIM-RXN]] | ||
| + | * [[GALACTOKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ALDOSE1EPIM-RXN]] |
| + | * [[GALACTOKIN-RXN]] | ||
| + | * [[RXN-11501]] | ||
| + | * [[RXN-11502]] | ||
| + | * [[RXN-12088]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-galactose}} |
| + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}} | ||
| + | {{#set: molecular-weight=180.157}} | ||
Revision as of 11:17, 15 January 2021
Contents
Metabolite ALPHA-D-GALACTOSE
- common-name:
- α-d-galactose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-phyprbdbsa-n
- molecular-weight:
- 180.157
