Difference between revisions of "CPD-17541"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11712 == * common-name: ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))...") |
(Created page with "Category:metabolite == Metabolite CPD-17541 == * common-name: ** dapdiamide c * smiles: ** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** mjpkmdapfrgjgv-f...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-17541 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dapdiamide c |
* smiles: | * smiles: | ||
| − | ** cc | + | ** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mjpkmdapfrgjgv-fbfnwgnusa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 314.341 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16293]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dapdiamide c}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mjpkmdapfrgjgv-fbfnwgnusa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=314.341}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-17541
- common-name:
- dapdiamide c
- smiles:
- cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
- inchi-key:
- mjpkmdapfrgjgv-fbfnwgnusa-n
- molecular-weight:
- 314.341
