Difference between revisions of "CPD-17541"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13722 RXN-13722] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/4.2...") |
(Created page with "Category:metabolite == Metabolite CPD-17541 == * common-name: ** dapdiamide c * smiles: ** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** mjpkmdapfrgjgv-f...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-17541 == |
| − | * | + | * common-name: |
| − | ** | + | ** dapdiamide c |
| − | * | + | * smiles: |
| − | ** [ | + | ** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o |
| − | = | + | * inchi-key: |
| − | + | ** mjpkmdapfrgjgv-fbfnwgnusa-n | |
| − | + | * molecular-weight: | |
| − | * | + | ** 314.341 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | == | + | * [[RXN-16293]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * | + | {{#set: common-name=dapdiamide c}} |
| − | == | + | {{#set: inchi-key=inchikey=mjpkmdapfrgjgv-fbfnwgnusa-n}} |
| − | + | {{#set: molecular-weight=314.341}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-17541
- common-name:
- dapdiamide c
- smiles:
- cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
- inchi-key:
- mjpkmdapfrgjgv-fbfnwgnusa-n
- molecular-weight:
- 314.341
