Difference between revisions of "CPD-17541"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17130 RXN-17130] == * direction: ** left-to-right * common-name: ** l-amino-acid oxidase * ec-n...")
(Created page with "Category:metabolite == Metabolite CPD-17541 == * common-name: ** dapdiamide c * smiles: ** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o * inchi-key: ** mjpkmdapfrgjgv-f...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17130 RXN-17130] ==
+
== Metabolite CPD-17541 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** l-amino-acid oxidase
+
** dapdiamide c
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.4.3.2 ec-1.4.3.2]
+
** cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PHE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIA]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[PHENYL-PYRUVATE]][c] '''+''' 1 [[PROTON]][c]
+
** mjpkmdapfrgjgv-fbfnwgnusa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ19480]]
+
** 314.341
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ00445]]
+
* [[RXN-16293]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=dapdiamide c}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=mjpkmdapfrgjgv-fbfnwgnusa-n}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=314.341}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=l-amino-acid oxidase}}
 
−
{{#set: ec-number=ec-1.4.3.2}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-17541

  • common-name:
    • dapdiamide c
  • smiles:
    • cc(c)cc(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
  • inchi-key:
    • mjpkmdapfrgjgv-fbfnwgnusa-n
  • molecular-weight:
    • 314.341

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-17541&oldid=138818"