Difference between revisions of "CPD-17543"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 56-Dihydrouracil20-in-tRNAs == * common-name: ** a 5,6-dihydrouracil20 in trna == Reaction(s) known to consume the compound == == Reactio...")
(Created page with "Category:metabolite == Metabolite CPD-17543 == * common-name: ** dapdiamide e * smiles: ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1) * inchi-key: ** bqmjfercspv...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 56-Dihydrouracil20-in-tRNAs ==
+
== Metabolite CPD-17543 ==
 
* common-name:
 
* common-name:
** a 5,6-dihydrouracil20 in trna
+
** dapdiamide e
 +
* smiles:
 +
** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1)
 +
* inchi-key:
 +
** bqmjfercspvsgr-lhzzqdsxsa-n
 +
* molecular-weight:
 +
** 316.313
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16294]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12456]]
+
* [[RXN-16294]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5,6-dihydrouracil20 in trna}}
+
{{#set: common-name=dapdiamide e}}
 +
{{#set: inchi-key=inchikey=bqmjfercspvsgr-lhzzqdsxsa-n}}
 +
{{#set: molecular-weight=316.313}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-17543

  • common-name:
    • dapdiamide e
  • smiles:
    • cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1)
  • inchi-key:
    • bqmjfercspvsgr-lhzzqdsxsa-n
  • molecular-weight:
    • 316.313

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality