Difference between revisions of "CPD-17543"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10244 == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] * inchi-key: ** mbmbgcfofbjsgt-kubavdmb...") |
(Created page with "Category:metabolite == Metabolite CPD-17543 == * common-name: ** dapdiamide e * smiles: ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1) * inchi-key: ** bqmjfercspv...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-17543 == |
* common-name: | * common-name: | ||
− | ** | + | ** dapdiamide e |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bqmjfercspvsgr-lhzzqdsxsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 316.313 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16294]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16294]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dapdiamide e}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bqmjfercspvsgr-lhzzqdsxsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=316.313}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-17543
- common-name:
- dapdiamide e
- smiles:
- cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1)
- inchi-key:
- bqmjfercspvsgr-lhzzqdsxsa-n
- molecular-weight:
- 316.313