Difference between revisions of "CPD-17543"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.11.2-RXN 1.14.11.2-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy...")
(Created page with "Category:metabolite == Metabolite CPD-10244 == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] * inchi-key: ** mbmbgcfofbjsgt-kubavdmb...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.14.11.2-RXN 1.14.11.2-RXN] ==
+
== Metabolite CPD-10244 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** docosahexaenoate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.11.2 ec-1.14.11.2]
+
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROCOLLAGEN-L-PROLINE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-6321]][c] '''+''' 1 [[SUC]][c]
+
** mbmbgcfofbjsgt-kubavdmbsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 327.486
−
* Gene: [[SJ21060]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-16063]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[RXN-16017]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-16063]]
−
* Gene: [[SJ17856]]
+
* [[RXN-16138]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=docosahexaenoate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=mbmbgcfofbjsgt-kubavdmbsa-m}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=327.486}}
−
* Gene: [[SJ10762]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ09957]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ20526]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ19825]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ20946]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ08884]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ02727]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ12047]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ13016]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ16355]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ14373]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ20511]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ19764]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
* [[PWY-7894]], procollagen hydroxylation and glycosylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7894 PWY-7894]
 
−
** '''1''' reactions found over '''6''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18946 18946]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03219 R03219]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P21195 P21195]
 
−
** [http://www.uniprot.org/uniprot/Q10576 Q10576]
 
−
** [http://www.uniprot.org/uniprot/P16924 P16924]
 
−
** [http://www.uniprot.org/uniprot/P13674 P13674]
 
−
** [http://www.uniprot.org/uniprot/P05307 P05307]
 
−
** [http://www.uniprot.org/uniprot/P09102 P09102]
 
−
** [http://www.uniprot.org/uniprot/P07237 P07237]
 
−
** [http://www.uniprot.org/uniprot/Q922C8 Q922C8]
 
−
** [http://www.uniprot.org/uniprot/P04785 P04785]
 
−
** [http://www.uniprot.org/uniprot/P54001 P54001]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.14.11.2}}
 
−
{{#set: nb gene associated=15}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-10244

  • common-name:
    • docosahexaenoate
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-]
  • inchi-key:
    • mbmbgcfofbjsgt-kubavdmbsa-m
  • molecular-weight:
    • 327.486

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-17543&oldid=48392"