Difference between revisions of "CPD-17543"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10244 == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] * inchi-key: ** mbmbgcfofbjsgt-kubavdmb...") |
(Created page with "Category:metabolite == Metabolite tRNA-uridine65 == * common-name: ** a uridine65 in trna == Reaction(s) known to consume the compound == * RXN-11840 == Reaction(s) kn...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite tRNA-uridine65 == |
* common-name: | * common-name: | ||
− | ** | + | ** a uridine65 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11840]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a uridine65 in trna}} |
− | |||
− |
Revision as of 14:59, 5 January 2021
Contents
Metabolite tRNA-uridine65
- common-name:
- a uridine65 in trna