Difference between revisions of "CPD-17545"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == * common-name: ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite CPD-7107 == * common-name: ** deoxycohumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c * inchi-key: ** kkfizykk...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE ==
+
== Metabolite CPD-7107 ==
 
* common-name:
 
* common-name:
** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
+
** deoxycohumulone
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
+
** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c
 
* inchi-key:
 
* inchi-key:
** whmxlrrvaneoog-mvfiekmpsa-l
+
** kkfizykkqlwbkh-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 715.004
+
** 331.431
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.42-RXN]]
+
* [[RXN-7813]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
+
{{#set: common-name=deoxycohumulone}}
{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
+
{{#set: inchi-key=inchikey=kkfizykkqlwbkh-uhfffaoysa-m}}
{{#set: molecular-weight=715.004}}
+
{{#set: molecular-weight=331.431}}

Revision as of 11:15, 15 January 2021

Metabolite CPD-7107

  • common-name:
    • deoxycohumulone
  • smiles:
    • cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(c(c)c)=o)o))c
  • inchi-key:
    • kkfizykkqlwbkh-uhfffaoysa-m
  • molecular-weight:
    • 331.431

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality