Difference between revisions of "CPD-17545"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10845 == * transcription-direction: ** positive * right-end-position: ** 350718 * left-end-position: ** 343313 * centisome-position: ** 89.58757...") |
(Created page with "Category:metabolite == Metabolite CPD-17545 == * common-name: ** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine * smiles: ** c([n+])c(c([o-])=o)nc(=o)c1(oc(...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17545 == |
− | * | + | * common-name: |
− | ** | + | ** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine |
− | * | + | * smiles: |
− | ** | + | ** c([n+])c(c([o-])=o)nc(=o)c1(oc(c(=o)n)1) |
− | * | + | * inchi-key: |
− | ** | + | ** neroffugairxgm-wxjvfsnfsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 217.181 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-16294]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-16294]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine}} | |
− | + | {{#set: inchi-key=inchikey=neroffugairxgm-wxjvfsnfsa-n}} | |
− | + | {{#set: molecular-weight=217.181}} | |
− | |||
− | |||
− | |||
− | {{#set: | ||
− | { | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-17545
- common-name:
- 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine
- smiles:
- c([n+])c(c([o-])=o)nc(=o)c1(oc(c(=o)n)1)
- inchi-key:
- neroffugairxgm-wxjvfsnfsa-n
- molecular-weight:
- 217.181
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.