Difference between revisions of "CPD-17621"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9903 == * common-name: ** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...")
(Created page with "Category:metabolite == Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P == * common-name: ** 3-deoxy-d-arabino-heptulosonate 7-phosphate * smiles: ** c(=o)([o-])c(=o)cc(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9903 ==
+
== Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
+
** 3-deoxy-d-arabino-heptulosonate 7-phosphate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
+
** c(=o)([o-])c(=o)cc(o)c(o)c(o)cop([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** lieylsgxgoxytd-ctbyciiysa-m
+
** pjwipexiffqaqz-pufimzngsa-k
 
* molecular-weight:
 
* molecular-weight:
** 629.941
+
** 285.124
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9287]]
+
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
 +
* [[DAHPSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DAHPSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: common-name=3-deoxy-d-arabino-heptulosonate 7-phosphate}}
{{#set: inchi-key=inchikey=lieylsgxgoxytd-ctbyciiysa-m}}
+
{{#set: inchi-key=inchikey=pjwipexiffqaqz-pufimzngsa-k}}
{{#set: molecular-weight=629.941}}
+
{{#set: molecular-weight=285.124}}

Revision as of 11:17, 15 January 2021

Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P

  • common-name:
    • 3-deoxy-d-arabino-heptulosonate 7-phosphate
  • smiles:
    • c(=o)([o-])c(=o)cc(o)c(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • pjwipexiffqaqz-pufimzngsa-k
  • molecular-weight:
    • 285.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality