Difference between revisions of "CPD-17621"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9903 == * common-name: ** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...")
(Created page with "Category:metabolite == Metabolite CPD-17621 == * common-name: ** 16-hydroxypalmitoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccccccccccccccco)cop(=o)(op(=o)(occ1(...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9903 ==
+
== Metabolite CPD-17621 ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxy-5-all-trans-heptaprenylbenzoate
+
** 16-hydroxypalmitoyl-coa
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccccccccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** lieylsgxgoxytd-ctbyciiysa-m
+
** rozgnndroqhxpf-bbecnahfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 629.941
+
** 1017.914
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9287]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16389]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: common-name=16-hydroxypalmitoyl-coa}}
{{#set: inchi-key=inchikey=lieylsgxgoxytd-ctbyciiysa-m}}
+
{{#set: inchi-key=inchikey=rozgnndroqhxpf-bbecnahfsa-j}}
{{#set: molecular-weight=629.941}}
+
{{#set: molecular-weight=1017.914}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-17621

  • common-name:
    • 16-hydroxypalmitoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccccccccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • rozgnndroqhxpf-bbecnahfsa-j
  • molecular-weight:
    • 1017.914

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality