Difference between revisions of "CPD-17624"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CREATINE == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi-key: ** cvsvtcorwbxhqv-uhfffaoysa-n * molecular-wei...")
(Created page with "Category:metabolite == Metabolite Amino-Acids-20 == * common-name: ** a proteinogenic amino acid == Reaction(s) known to consume the compound == * L-AMINO-ACID-OXIDASE-R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CREATINE ==
+
== Metabolite Amino-Acids-20 ==
 
* common-name:
 
* common-name:
** creatine
+
** a proteinogenic amino acid
* smiles:
 
** c(c(=o)[o-])n(c)c(n)=[n+]
 
* inchi-key:
 
** cvsvtcorwbxhqv-uhfffaoysa-n
 
* molecular-weight:
 
** 131.134
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CREATINASE-RXN]]
+
* [[L-AMINO-ACID-OXIDASE-RXN]]
* [[CREATINE-KINASE-RXN]]
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
* [[CREATININASE-RXN]]
+
* [[RXN-6601]]
 +
* [[RXN66-336]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CREATINE-KINASE-RXN]]
+
* [[3.4.11.1-RXN]]
* [[CREATININASE-RXN]]
+
* [[3.4.11.4-RXN]]
* [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]]
+
* [[3.4.13.18-RXN]]
 +
* [[3.4.13.9-RXN]]
 +
* [[3.4.16.2-RXN]]
 +
* [[3.4.17.19-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[RXN0-5204]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=creatine}}
+
{{#set: common-name=a proteinogenic amino acid}}
{{#set: inchi-key=inchikey=cvsvtcorwbxhqv-uhfffaoysa-n}}
 
{{#set: molecular-weight=131.134}}
 

Revision as of 15:24, 5 January 2021