Difference between revisions of "CPD-17638"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-Me-Branched-234-Sat-FALD == * common-name: ** a 2-methyl branched 2,3,4-saturated fatty aldehyde == Reaction(s) known to consume the co...") |
(Created page with "Category:metabolite == Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE == * common-name: ** udp-n-acetyl-α-d-glucosamine-enolpyruvate * smiles: ** c=c(oc3(c(o)c(co)oc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** udp-n-acetyl-α-d-glucosamine-enolpyruvate |
| + | * smiles: | ||
| + | ** c=c(oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3))c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** begzzypuncjhkp-dbywsuqtsa-k | ||
| + | * molecular-weight: | ||
| + | ** 674.382 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[UDPNACETYLMURAMATEDEHYDROG-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=udp-n-acetyl-α-d-glucosamine-enolpyruvate}} |
| + | {{#set: inchi-key=inchikey=begzzypuncjhkp-dbywsuqtsa-k}} | ||
| + | {{#set: molecular-weight=674.382}} | ||
Revision as of 08:24, 15 March 2021
Contents
Metabolite UDP-ACETYL-CARBOXYVINYL-GLUCOSAMINE
- common-name:
- udp-n-acetyl-α-d-glucosamine-enolpyruvate
- smiles:
- c=c(oc3(c(o)c(co)oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(nc(c)=o)3))c(=o)[o-]
- inchi-key:
- begzzypuncjhkp-dbywsuqtsa-k
- molecular-weight:
- 674.382
