Difference between revisions of "CPD-17638"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09783 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-14903 ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-17638 == * common-name: ** 7-hydroxylauroyl-coa * smiles: ** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17638 == |
− | == | + | * common-name: |
− | + | ** 7-hydroxylauroyl-coa | |
− | = | + | * smiles: |
− | + | ** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | + | * inchi-key: | |
− | * | + | ** rxedusgpuqqzew-xirpngcasa-j |
− | + | * molecular-weight: | |
− | + | ** 961.807 | |
− | ** | + | == Reaction(s) known to consume the compound == |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12184]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | == | + | {{#set: common-name=7-hydroxylauroyl-coa}} |
− | + | {{#set: inchi-key=inchikey=rxedusgpuqqzew-xirpngcasa-j}} | |
− | + | {{#set: molecular-weight=961.807}} | |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-17638
- common-name:
- 7-hydroxylauroyl-coa
- smiles:
- cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- rxedusgpuqqzew-xirpngcasa-j
- molecular-weight:
- 961.807