Difference between revisions of "CPD-17638"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09783 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-14903 ** Category:...")
(Created page with "Category:metabolite == Metabolite CPD-17638 == * common-name: ** 7-hydroxylauroyl-coa * smiles: ** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09783 ==
+
== Metabolite CPD-17638 ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** 7-hydroxylauroyl-coa
== Reaction(s) associated ==
+
* smiles:
* [[RXN-14903]]
+
** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** rxedusgpuqqzew-xirpngcasa-j
* [[RXN0-7008]]
+
* molecular-weight:
** Category: [[orthology]]
+
** 961.807
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to consume the compound ==
* [[RXN66-542]]
+
== Reaction(s) known to produce the compound ==
** Category: [[orthology]]
+
* [[RXN-12184]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) associated ==
+
{{#set: common-name=7-hydroxylauroyl-coa}}
* [[PWY-6922]]
+
{{#set: inchi-key=inchikey=rxedusgpuqqzew-xirpngcasa-j}}
** '''5''' reactions found over '''7''' reactions in the full pathway
+
{{#set: molecular-weight=961.807}}
* [[PROUT-PWY]]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-5737]]
 
** '''1''' reactions found over '''6''' reactions in the full pathway
 
* [[CITRULBIO-PWY]]
 
** '''7''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY0-1544]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-17638

  • common-name:
    • 7-hydroxylauroyl-coa
  • smiles:
    • cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • rxedusgpuqqzew-xirpngcasa-j
  • molecular-weight:
    • 961.807

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality