Difference between revisions of "CPD-17638"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Guanine26-in-tRNA == * common-name: ** a guanine26 in trna == Reaction(s) known to consume the compound == * RXN-12375 * [[RXN-12377]...")
(Created page with "Category:metabolite == Metabolite CPD-17638 == * common-name: ** 7-hydroxylauroyl-coa * smiles: ** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Guanine26-in-tRNA ==
+
== Metabolite CPD-17638 ==
 
* common-name:
 
* common-name:
** a guanine26 in trna
+
** 7-hydroxylauroyl-coa
 +
* smiles:
 +
** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** rxedusgpuqqzew-xirpngcasa-j
 +
* molecular-weight:
 +
** 961.807
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12375]]
 
* [[RXN-12377]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12184]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a guanine26 in trna}}
+
{{#set: common-name=7-hydroxylauroyl-coa}}
 +
{{#set: inchi-key=inchikey=rxedusgpuqqzew-xirpngcasa-j}}
 +
{{#set: molecular-weight=961.807}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-17638

  • common-name:
    • 7-hydroxylauroyl-coa
  • smiles:
    • cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • rxedusgpuqqzew-xirpngcasa-j
  • molecular-weight:
    • 961.807

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality