Difference between revisions of "CPD-17757"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13755 == * common-name: ** 5-hydroxy-3-[(3as,4s,5r,7as)-7a-methyl-1,5-dioxo-octahydro-1h-inden-4-yl]propanoyl-coa * smiles: ** cc(c)(...") |
(Created page with "Category:metabolite == Metabolite CPD-17757 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate * smiles: ** cc(=o)nc2(c(o)oc(c...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-17757 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate |
* smiles: | * smiles: | ||
− | ** cc( | + | ** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bujztfindcqrgp-zdlrkiohsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 457.362 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16512]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-16512]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bujztfindcqrgp-zdlrkiohsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=457.362}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-17757
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate
- smiles:
- cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
- inchi-key:
- bujztfindcqrgp-zdlrkiohsa-l
- molecular-weight:
- 457.362