Difference between revisions of "CPD-17757"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-N-omega-dimethyl-arginine == * common-name: ** [protein]-nω,nω-dimethyl-l-arginine == Reaction(s) known to consume th...")
(Created page with "Category:metabolite == Metabolite CPD-17757 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate * smiles: ** cc(=o)nc2(c(o)oc(c...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-N-omega-dimethyl-arginine ==
+
== Metabolite CPD-17757 ==
 
* common-name:
 
* common-name:
** [protein]-nω,nω-dimethyl-l-arginine
+
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate
 +
* smiles:
 +
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
 +
* inchi-key:
 +
** bujztfindcqrgp-zdlrkiohsa-l
 +
* molecular-weight:
 +
** 457.362
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17121]]
+
* [[RXN-16512]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16891]]
+
* [[RXN-16512]]
* [[RXN-17121]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=[protein]-nω,nω-dimethyl-l-arginine}}
+
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate}}
 +
{{#set: inchi-key=inchikey=bujztfindcqrgp-zdlrkiohsa-l}}
 +
{{#set: molecular-weight=457.362}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-17757

  • common-name:
    • 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate
  • smiles:
    • cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
  • inchi-key:
    • bujztfindcqrgp-zdlrkiohsa-l
  • molecular-weight:
    • 457.362

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality