Difference between revisions of "CPD-17757"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2351 == * common-name: ** a trna precursor with a 5' extension and a long 3' trailer == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CPD-17757 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate * smiles: ** cc(=o)nc2(c(o)oc(c...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17757 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate |
| + | * smiles: | ||
| + | ** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) | ||
| + | * inchi-key: | ||
| + | ** bujztfindcqrgp-zdlrkiohsa-l | ||
| + | * molecular-weight: | ||
| + | ** 457.362 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16512]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16512]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate}} |
| + | {{#set: inchi-key=inchikey=bujztfindcqrgp-zdlrkiohsa-l}} | ||
| + | {{#set: molecular-weight=457.362}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-17757
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate
- smiles:
- cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
- inchi-key:
- bujztfindcqrgp-zdlrkiohsa-l
- molecular-weight:
- 457.362
