|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LEUCINE--TRNA-LIGASE-RXN LEUCINE--TRNA-LIGASE-RXN] == | + | == Metabolite CPD-17757 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** leucine-trna ligase | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.1.1.4 ec-6.1.1.4] | + | ** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[LEU]][c] '''+''' 1 [[LEU-tRNAs]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Charged-LEU-tRNAs]][c] '''+''' 1 [[PPI]][c]
| + | ** bujztfindcqrgp-zdlrkiohsa-l |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ12222]]
| + | ** 457.362 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-16512]] |
| − | * Gene: [[SJ12219]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]] | + | * [[RXN-16512]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ12220]]
| + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-glucosamine 6-sulfate}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=bujztfindcqrgp-zdlrkiohsa-l}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: molecular-weight=457.362}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ16362]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] | |
| − | ** '''21''' reactions found over '''21''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11689 11689]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03657 R03657]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/O27552 O27552]
| |
| − | ** [http://www.uniprot.org/uniprot/P56457 P56457]
| |
| − | ** [http://www.uniprot.org/uniprot/O51267 O51267]
| |
| − | ** [http://www.uniprot.org/uniprot/O83595 O83595]
| |
| − | ** [http://www.uniprot.org/uniprot/O84211 O84211]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9Z930 Q9Z930]
| |
| − | ** [http://www.uniprot.org/uniprot/P47508 P47508]
| |
| − | ** [http://www.uniprot.org/uniprot/P36430 P36430]
| |
| − | ** [http://www.uniprot.org/uniprot/O66680 O66680]
| |
| − | ** [http://www.uniprot.org/uniprot/O67646 O67646]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZDB1 Q9ZDB1]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9WY15 Q9WY15]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PNK3 Q9PNK3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JW39 Q9JW39]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZJ63 Q9ZJ63]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JXT2 Q9JXT2]
| |
| − | ** [http://www.uniprot.org/uniprot/P43827 P43827]
| |
| − | ** [http://www.uniprot.org/uniprot/O58698 O58698]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CHB6 Q9CHB6]
| |
| − | ** [http://www.uniprot.org/uniprot/P26637 P26637]
| |
| − | ** [http://www.uniprot.org/uniprot/P75398 P75398]
| |
| − | ** [http://www.uniprot.org/uniprot/P73274 P73274]
| |
| − | ** [http://www.uniprot.org/uniprot/Q48955 Q48955]
| |
| − | ** [http://www.uniprot.org/uniprot/Q48964 Q48964]
| |
| − | ** [http://www.uniprot.org/uniprot/Q49051 Q49051]
| |
| − | ** [http://www.uniprot.org/uniprot/P11325 P11325]
| |
| − | ** [http://www.uniprot.org/uniprot/P07813 P07813]
| |
| − | ** [http://www.uniprot.org/uniprot/P10857 P10857]
| |
| − | ** [http://www.uniprot.org/uniprot/P15181 P15181]
| |
| − | ** [http://www.uniprot.org/uniprot/Q50192 Q50192]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=leucine-trna ligase}} | |
| − | {{#set: ec-number=ec-6.1.1.4}}
| |
| − | {{#set: nb gene associated=4}}
| |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}} | |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
