Difference between revisions of "CPD-178"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18680 == * transcription-direction: ** negative * right-end-position: ** 88546 * left-end-position: ** 80853 * centisome-position: ** 33.818527...") |
(Created page with "Category:metabolite == Metabolite CPD-178 == * common-name: ** d-myo-inositol (3,4,5,6)-tetrakisphosphate * smiles: ** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-178 == |
− | * | + | * common-name: |
− | ** | + | ** d-myo-inositol (3,4,5,6)-tetrakisphosphate |
− | + | * smiles: | |
− | + | ** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) | |
− | + | * inchi-key: | |
− | + | ** mrvyfoanpdtyby-uzaagftcsa-f | |
− | * | + | * molecular-weight: |
− | ** | + | ** 492.013 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[2.7.1.134-RXN]] | |
− | = | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=d-myo-inositol (3,4,5,6)-tetrakisphosphate}} |
− | ** | + | {{#set: inchi-key=inchikey=mrvyfoanpdtyby-uzaagftcsa-f}} |
− | * | + | {{#set: molecular-weight=492.013}} |
− | ** | ||
− | * [[ | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-178
- common-name:
- d-myo-inositol (3,4,5,6)-tetrakisphosphate
- smiles:
- c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- mrvyfoanpdtyby-uzaagftcsa-f
- molecular-weight:
- 492.013