Difference between revisions of "CPD-17813"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OH-PYR == * common-name: ** hydroxypyruvate * smiles: ** c(c(=o)c([o-])=o)o * inchi-key: ** hhddccuiiuwngj-uhfffaoysa-m * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite CPD-17813 == * common-name: ** (2e,11z)-hexadec-2,11-dienoyl-coa * smiles: ** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OH-PYR ==
+
== Metabolite CPD-17813 ==
 
* common-name:
 
* common-name:
** hydroxypyruvate
+
** (2e,11z)-hexadec-2,11-dienoyl-coa
 
* smiles:
 
* smiles:
** c(c(=o)c([o-])=o)o
+
** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** hhddccuiiuwngj-uhfffaoysa-m
+
** amssmxhtrodksm-fyyfncousa-j
 
* molecular-weight:
 
* molecular-weight:
** 103.054
+
** 997.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HYDROXYPYRUVATE-REDUCTASE-RXN]]
+
* [[RXN-16558]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HYDROXYPYRUVATE-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hydroxypyruvate}}
+
{{#set: common-name=(2e,11z)-hexadec-2,11-dienoyl-coa}}
{{#set: inchi-key=inchikey=hhddccuiiuwngj-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=amssmxhtrodksm-fyyfncousa-j}}
{{#set: molecular-weight=103.054}}
+
{{#set: molecular-weight=997.883}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17813

  • common-name:
    • (2e,11z)-hexadec-2,11-dienoyl-coa
  • smiles:
    • ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • amssmxhtrodksm-fyyfncousa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality