Difference between revisions of "CPD-17813"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OH-PYR == * common-name: ** hydroxypyruvate * smiles: ** c(c(=o)c([o-])=o)o * inchi-key: ** hhddccuiiuwngj-uhfffaoysa-m * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite CPD-17813 == * common-name: ** (2e,11z)-hexadec-2,11-dienoyl-coa * smiles: ** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-17813 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2e,11z)-hexadec-2,11-dienoyl-coa |
* smiles: | * smiles: | ||
− | ** c(c(=o)c([o-])= | + | ** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** amssmxhtrodksm-fyyfncousa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 997.883 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16558]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2e,11z)-hexadec-2,11-dienoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=amssmxhtrodksm-fyyfncousa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=997.883}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-17813
- common-name:
- (2e,11z)-hexadec-2,11-dienoyl-coa
- smiles:
- ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
- inchi-key:
- amssmxhtrodksm-fyyfncousa-j
- molecular-weight:
- 997.883