Difference between revisions of "CPD-17813"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09222 == * transcription-direction: ** positive * right-end-position: ** 418853 * left-end-position: ** 409040 * centisome-position: ** 96.58377...")
 
(Created page with "Category:metabolite == Metabolite CPD-17813 == * common-name: ** (2e,11z)-hexadec-2,11-dienoyl-coa * smiles: ** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09222 ==
+
== Metabolite CPD-17813 ==
* transcription-direction:
+
* common-name:
** positive
+
** (2e,11z)-hexadec-2,11-dienoyl-coa
* right-end-position:
+
* smiles:
** 418853
+
** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
* left-end-position:
+
* inchi-key:
** 409040
+
** amssmxhtrodksm-fyyfncousa-j
* centisome-position:
+
* molecular-weight:
** 96.58377   
+
** 997.883
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16558]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.1.3.16-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(2e,11z)-hexadec-2,11-dienoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=amssmxhtrodksm-fyyfncousa-j}}
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: molecular-weight=997.883}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=418853}}
 
{{#set: left-end-position=409040}}
 
{{#set: centisome-position=96.58377    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17813

  • common-name:
    • (2e,11z)-hexadec-2,11-dienoyl-coa
  • smiles:
    • ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • amssmxhtrodksm-fyyfncousa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality