Difference between revisions of "CPD-17813"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14287 == * transcription-direction: ** positive * right-end-position: ** 315818 * left-end-position: ** 284899 * centisome-position: ** 88.51369...") |
(Created page with "Category:metabolite == Metabolite CPD-17813 == * common-name: ** (2e,11z)-hexadec-2,11-dienoyl-coa * smiles: ** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17813 == |
− | * | + | * common-name: |
− | ** | + | ** (2e,11z)-hexadec-2,11-dienoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o |
− | * | + | * inchi-key: |
− | ** | + | ** amssmxhtrodksm-fyyfncousa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 997.883 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-16558]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=(2e,11z)-hexadec-2,11-dienoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=amssmxhtrodksm-fyyfncousa-j}} | |
− | {{#set: | + | {{#set: molecular-weight=997.883}} |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-17813
- common-name:
- (2e,11z)-hexadec-2,11-dienoyl-coa
- smiles:
- ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
- inchi-key:
- amssmxhtrodksm-fyyfncousa-j
- molecular-weight:
- 997.883