Difference between revisions of "CPD-17814"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-452 == * common-name: ** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite CPD-17814 == * common-name: ** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa * smiles: ** ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-17814 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa |
| + | * smiles: | ||
| + | ** ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o | ||
| + | * inchi-key: | ||
| + | ** shgdvnglfxviak-bfvorphasa-j | ||
| + | * molecular-weight: | ||
| + | ** 1015.898 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16559]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16558]] |
| + | * [[RXN-16559]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(11z)-(s)-3-hydroxyhexadec-11-enoyl-coa}} |
| + | {{#set: inchi-key=inchikey=shgdvnglfxviak-bfvorphasa-j}} | ||
| + | {{#set: molecular-weight=1015.898}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-17814
- common-name:
- (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa
- smiles:
- ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
- inchi-key:
- shgdvnglfxviak-bfvorphasa-j
- molecular-weight:
- 1015.898
