Difference between revisions of "CPD-17815"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19487 == * common-name: ** 3-isopropyl-10-(methylthio)-2-oxodecanoate * smiles: ** cscccccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: *...")
(Created page with "Category:metabolite == Metabolite CPD-8076 == * common-name: ** 1-18:3-2-16:1-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19487 ==
+
== Metabolite CPD-8076 ==
 
* common-name:
 
* common-name:
** 3-isopropyl-10-(methylthio)-2-oxodecanoate
+
** 1-18:3-2-16:1-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** cscccccccc(c(=o)c(=o)[o-])c(=o)[o-]
+
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** ukhzbtwecwuvph-uhfffaoysa-l
+
** syspljxkzrpipm-lwnbrhqxsa-n
 
* molecular-weight:
 
* molecular-weight:
** 274.331
+
** 751.052
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18200]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18200]]
+
* [[RXN-8297]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-isopropyl-10-(methylthio)-2-oxodecanoate}}
+
{{#set: common-name=1-18:3-2-16:1-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=ukhzbtwecwuvph-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=syspljxkzrpipm-lwnbrhqxsa-n}}
{{#set: molecular-weight=274.331}}
+
{{#set: molecular-weight=751.052}}

Revision as of 18:53, 14 January 2021

Metabolite CPD-8076

  • common-name:
    • 1-18:3-2-16:1-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
  • inchi-key:
    • syspljxkzrpipm-lwnbrhqxsa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality