Difference between revisions of "CPD-17866"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-DEHYDROGLUCONATE == * common-name: ** 5-dehydro-d-gluconate * smiles: ** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** izsrjdgcgrauar-...") |
(Created page with "Category:metabolite == Metabolite 5-Methylcytosine-38-in-tRNAs == * common-name: ** a 5-methylcytosine38 in trna == Reaction(s) known to consume the compound == == Reactio...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite 5- | + | == Metabolite 5-Methylcytosine-38-in-tRNAs == |
* common-name: | * common-name: | ||
| − | ** 5- | + | ** a 5-methylcytosine38 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11855]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=5- | + | {{#set: common-name=a 5-methylcytosine38 in trna}} |
| − | |||
| − | |||
Revision as of 13:07, 14 January 2021
Contents
Metabolite 5-Methylcytosine-38-in-tRNAs
- common-name:
- a 5-methylcytosine38 in trna
