Difference between revisions of "CPD-1789"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-1789 == * common-name: ** dehydro-d-arabinono-1,4-lactone * smiles: ** c(o)c1(c(o)=c(o)c(=o)o1) * inchi-key: ** zzzcuofihgpkak-uwtatz...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17371 ==
+
== Metabolite CPD-1789 ==
 
* common-name:
 
* common-name:
** 18-hydroxylinoleoyl-coa
+
** dehydro-d-arabinono-1,4-lactone
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(o)c1(c(o)=c(o)c(=o)o1)
 
* inchi-key:
 
* inchi-key:
** hjegylshikpenr-daxvlclxsa-j
+
** zzzcuofihgpkak-uwtatzphsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 146.099
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16118]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.3.37-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxylinoleoyl-coa}}
+
{{#set: common-name=dehydro-d-arabinono-1,4-lactone}}
{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
+
{{#set: inchi-key=inchikey=zzzcuofihgpkak-uwtatzphsa-n}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=146.099}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-1789

  • common-name:
    • dehydro-d-arabinono-1,4-lactone
  • smiles:
    • c(o)c1(c(o)=c(o)c(=o)o1)
  • inchi-key:
    • zzzcuofihgpkak-uwtatzphsa-n
  • molecular-weight:
    • 146.099

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality