Difference between revisions of "CPD-1789"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13020 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(o...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17371 == |
− | == | + | * common-name: |
− | + | ** 18-hydroxylinoleoyl-coa | |
− | = | + | * smiles: |
− | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | ** | + | * inchi-key: |
− | *** | + | ** hjegylshikpenr-daxvlclxsa-j |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 1041.936 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-16118]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=18-hydroxylinoleoyl-coa}} | ||
+ | {{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}} | ||
+ | {{#set: molecular-weight=1041.936}} |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-17371
- common-name:
- 18-hydroxylinoleoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- hjegylshikpenr-daxvlclxsa-j
- molecular-weight:
- 1041.936