Difference between revisions of "CPD-17894"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-4-DEHYDROGENASE-RXN PYRIDOXINE-4-DEHYDROGENASE-RXN] == * direction: ** reversible * comm...")
(Created page with "Category:metabolite == Metabolite CPD-17894 == * common-name: ** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate) * smiles: ** cc(c)cccc(c)=cccc(c)=cccc(c)=ccc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-4-DEHYDROGENASE-RXN PYRIDOXINE-4-DEHYDROGENASE-RXN] ==
+
== Metabolite CPD-17894 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** pyridoxine 4-dehydrogenase/pyridoxal reductase
+
** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.1.1.65 ec-1.1.1.65]
+
** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NADP]][c] '''+''' 1 [[PYRIDOXINE]][c] '''<=>''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PYRIDOXAL]][c]
+
** mbyvktiiznuhkn-nivaaieqsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ15799]]
+
** 1012.461
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ20140]]
+
* [[RXN-16602]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=&beta;-d-mannosyl-(c55 &omega;-saturated dolichyl phosphate)}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=mbyvktiiznuhkn-nivaaieqsa-m}}
−
* [[PWY-7204]], pyridoxal 5'-phosphate salvage II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204]
+
{{#set: molecular-weight=1012.461}}
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7282]], 4-amino-2-methyl-5-diphosphomethylpyrimidine biosynthesis (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7282 PWY-7282]
 
−
** '''6''' reactions found over '''9''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16132 16132]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R01708 R01708]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/O14295 O14295]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=pyridoxine 4-dehydrogenase/pyridoxal reductase}}
 
−
{{#set: ec-number=ec-1.1.1.65}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=2}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-17894

  • common-name:
    • β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
  • smiles:
    • cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
  • inchi-key:
    • mbyvktiiznuhkn-nivaaieqsa-m
  • molecular-weight:
    • 1012.461

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-17894&oldid=138634"