Difference between revisions of "CPD-17894"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-adenine-37 == * common-name: ** an adenine37 in trna == Reaction(s) known to consume the compound == * RXN-14570 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-17894 == * common-name: ** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate) * smiles: ** cc(c)cccc(c)=cccc(c)=cccc(c)=ccc...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17894 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-mannosyl-(c55 ω-saturated dolichyl phosphate) |
| + | * smiles: | ||
| + | ** cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c | ||
| + | * inchi-key: | ||
| + | ** mbyvktiiznuhkn-nivaaieqsa-m | ||
| + | * molecular-weight: | ||
| + | ** 1012.461 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16602]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)}} |
| + | {{#set: inchi-key=inchikey=mbyvktiiznuhkn-nivaaieqsa-m}} | ||
| + | {{#set: molecular-weight=1012.461}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-17894
- common-name:
- β-d-mannosyl-(c55 ω-saturated dolichyl phosphate)
- smiles:
- cc(c)cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(ccop(=o)([o-])oc1(oc(co)c(o)c(o)c(o)1))c
- inchi-key:
- mbyvktiiznuhkn-nivaaieqsa-m
- molecular-weight:
- 1012.461
