Difference between revisions of "CPD-18"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12496 RXN-12496] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-18 == * common-name: ** linoleoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-18 == |
| − | * | + | * common-name: |
| − | ** | + | ** linoleoyl-coa |
| − | * | + | * smiles: |
| − | ** [ | + | ** cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | == | + | * inchi-key: |
| − | + | ** yecllimzhnyfck-rrnjgntnsa-j | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 1025.937 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[1.14.19.3-RXN]] |
| − | == | + | * [[FACOAE182]] |
| − | + | * [[LINOLEOYL-RXN]] | |
| − | * | + | * [[RXN-16094]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[LNLCCOAL]] |
| − | {{#set: | + | * [[RXN-16045]] |
| − | {{#set: | + | * [[RXN-9601]] |
| − | + | * [[RXN-9673]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=linoleoyl-coa}} | |
| − | + | {{#set: inchi-key=inchikey=yecllimzhnyfck-rrnjgntnsa-j}} | |
| − | + | {{#set: molecular-weight=1025.937}} | |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-18
- common-name:
- linoleoyl-coa
- smiles:
- cccccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- yecllimzhnyfck-rrnjgntnsa-j
- molecular-weight:
- 1025.937
