Difference between revisions of "CPD-18076"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07545 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 2.7.10.1-RXN ** Catego...")
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ07545 ==
+
== Metabolite GTP ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** gtp
== Reaction(s) associated ==
+
* smiles:
* [[2.7.10.1-RXN]]
+
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** xkmlyualxhknft-uuokfmhzsa-j
* [[3.6.4.4-RXN]]
+
* molecular-weight:
** Category: [[orthology]]
+
** 519.151
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
** Category: [[orthology]]
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[FE2GTPabc]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[GTCY]]
{{#set: nb reaction associated=3}}
+
* [[GTP-CYCLOHYDRO-I-RXN]]
 +
* [[GTP-CYCLOHYDRO-II-RXN]]
 +
* [[GTPPYPHOSKIN-RXN]]
 +
* [[GTUP]]
 +
* [[GUANYLCYC-RXN]]
 +
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 +
* [[NTDP]]
 +
* [[RXN-12502]]
 +
* [[RXN-12504]]
 +
* [[RXN-14140]]
 +
* [[RXN-14201]]
 +
* [[RXN-15713]]
 +
* [[RXN-17921]]
 +
* [[RXN-8340]]
 +
* [[RXN-8988]]
 +
* [[RXN0-5462]]
 +
* [[RXN0-746]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[URKI-RXN]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[3.6.1.17-RXN]]
 +
* [[ATGD]]
 +
* [[GDPKIN-RXN]]
 +
* [[GTPOP]]
 +
* [[RXN-14117]]
 +
* [[RXN0-6427]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=gtp}}
 +
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}
 +
{{#set: molecular-weight=519.151}}

Revision as of 20:34, 18 December 2020