Difference between revisions of "CPD-18076"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...") |
(Created page with "Category:metabolite == Metabolite Hyaluronan-NAc-glucosaminide == * common-name: ** n-acetyl-α-d-glucosaminyl-[hyaluronan] == Reaction(s) known to consume the compou...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Hyaluronan-NAc-glucosaminide == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-α-d-glucosaminyl-[hyaluronan] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[2.4.1.212-RXN]] | |
| − | + | * [[RXN-11627]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11627]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-α-d-glucosaminyl-[hyaluronan]}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite Hyaluronan-NAc-glucosaminide
- common-name:
- n-acetyl-α-d-glucosaminyl-[hyaluronan]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "n-acetyl-α-d-glucosaminyl-[hyaluronan" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
