Difference between revisions of "CPD-18077"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9896 == * common-name: ** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
(Created page with "Category:metabolite == Metabolite CPD-24184 == == Reaction(s) known to consume the compound == * RXN-22206 == Reaction(s) known to produce the compound == == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9896 ==
+
== Metabolite CPD-24184 ==
* common-name:
 
** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
 
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
** fmsczymouyoenk-opsrswoasa-m
 
* molecular-weight:
 
** 766.178
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9281]]
+
* [[RXN-22206]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-nonaprenylbenzoate}}
 
{{#set: inchi-key=inchikey=fmsczymouyoenk-opsrswoasa-m}}
 
{{#set: molecular-weight=766.178}}
 

Revision as of 08:26, 15 March 2021

Metabolite CPD-24184

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality